C30H35N3O5 — CID 73340527
N-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-3-prop-2-enyl-1-[(2,4,6-trimethylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide (PubChem CID 73340527) has the molecular formula C30H35N3O5 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-3-prop-2-enyl-1-[(2,4,6-trimethylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-3-prop-2-enyl-1-[(2,4,6-trimethylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 73340527 |
| Molecular Formula | C30H35N3O5 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,4-dioxo-3-prop-2-enyl-1-[(2,4,6-trimethylphenyl)methyl]-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide |
| SMILES | C=CCN1C(=O)C2CCC(C(=O)NCc3ccc4c(c3)OCO4)CC2N(Cc2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C30H35N3O5/c1-5-10-32-29(35)23-8-7-22(28(34)31-15-21-6-9-26-27(13-21)38-17-37-26)14-25(23)33(30(32)36)16-24-19(3)11-18(2)12-20(24)4/h5-6,9,11-13,22-23,25H,1,7-8,10,14-17H2,2-4H3,(H,31,34) |
| InChIKey | NSJXXIZHYKFSTP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|