C28H28F2N4O6 — CID 73340536
N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide (PubChem CID 73340536) has the molecular formula C28H28F2N4O6 and a molecular weight of 554.55 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide |
|---|---|
| PubChem CID | 73340536 |
| Molecular Formula | C28H28F2N4O6 |
| Molecular Weight | 554.55 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-1-[2-(2,4-difluoroanilino)-2-oxoethyl]-2,4-dioxo-3-prop-2-enyl-4a,5,6,7,8,8a-hexahydroquinazoline-7-carboxamide |
| SMILES | C=CCN1C(=O)C2CCC(C(=O)NCc3ccc4c(c3)OCO4)CC2N(CC(=O)Nc2ccc(F)cc2F)C1=O |
| InChI | InChI=1S/C28H28F2N4O6/c1-2-9-33-27(37)19-6-4-17(26(36)31-13-16-3-8-23-24(10-16)40-15-39-23)11-22(19)34(28(33)38)14-25(35)32-21-7-5-18(29)12-20(21)30/h2-3,5,7-8,10,12,17,19,22H,1,4,6,9,11,13-15H2,(H,31,36)(H,32,35) |
| InChIKey | RSWBXVYFILCXJE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.55 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|