C25H37NO6 — CID 73345973
(1R,4S,5R,9R,10S,11S,13R,15R)-15-hydroxy-5,9-dimethyl-14-methylidene-11-(morpholine-4-carbonyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid (PubChem CID 73345973) has the molecular formula C25H37NO6 and a molecular weight of 447.57 g/mol. Its IUPAC name is (1R,4S,5R,9R,10S,11S,13R,15R)-15-hydroxy-5,9-dimethyl-14-methylidene-11-(morpholine-4-carbonyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid.
| Compound Name | (1R,4S,5R,9R,10S,11S,13R,15R)-15-hydroxy-5,9-dimethyl-14-methylidene-11-(morpholine-4-carbonyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
|---|---|
| PubChem CID | 73345973 |
| Molecular Formula | C25H37NO6 |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (1R,4S,5R,9R,10S,11S,13R,15R)-15-hydroxy-5,9-dimethyl-14-methylidene-11-(morpholine-4-carbonyloxy)tetracyclo[11.2.1.01,10.04,9]hexadecane-5-carboxylic acid |
| SMILES | C=C1[C@H]2C[C@H](OC(=O)N3CCOCC3)[C@H]3[C@]4(C)CCC[C@@](C)(C(=O)O)[C@H]4CC[C@]3(C2)[C@@H]1O |
| InChI | InChI=1S/C25H37NO6/c1-15-16-13-17(32-22(30)26-9-11-31-12-10-26)19-23(2)6-4-7-24(3,21(28)29)18(23)5-8-25(19,14-16)20(15)27/h16-20,27H,1,4-14H2,2-3H3,(H,28,29)/t16-,17-,18-,19-,20+,23+,24+,25+/m0/s1 |
| InChIKey | OGKWFECHZFSMHK-SLBIUEALSA-N |
| XLogP | 3.46 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|