C24H29ClN6O2 — CID 73346556
N-[[3-(4-chlorophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine (PubChem CID 73346556) has the molecular formula C24H29ClN6O2 and a molecular weight of 468.99 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine.
| Compound Name | N-[[3-(4-chlorophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 73346556 |
| Molecular Formula | C24H29ClN6O2 |
| Molecular Weight | 468.99 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1-(4-nitrophenyl)pyrazol-4-yl]methyl]-3-(4-methylpiperazin-1-yl)propan-1-amine |
| SMILES | CN1CCN(CCCNCc2cn(-c3ccc([N+](=O)[O-])cc3)nc2-c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H29ClN6O2/c1-28-13-15-29(16-14-28)12-2-11-26-17-20-18-30(22-7-9-23(10-8-22)31(32)33)27-24(20)19-3-5-21(25)6-4-19/h3-10,18,26H,2,11-17H2,1H3 |
| InChIKey | DQOYFFAEYFZTJB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.99 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|