C25H24N4O4S — CID 73348960
(NE)-N-[1-phenyl-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylidene]hydroxylamine (PubChem CID 73348960) has the molecular formula C25H24N4O4S and a molecular weight of 476.56 g/mol. Its IUPAC name is (NE)-N-[1-phenyl-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylidene]hydroxylamine.
| Compound Name | (NE)-N-[1-phenyl-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 73348960 |
| Molecular Formula | C25H24N4O4S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | (NE)-N-[1-phenyl-2-[[4-phenyl-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethylidene]hydroxylamine |
| SMILES | COc1cc(-c2nnc(SC/C(=N/O)c3ccccc3)n2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O4S/c1-31-21-14-18(15-22(32-2)23(21)33-3)24-26-27-25(29(24)19-12-8-5-9-13-19)34-16-20(28-30)17-10-6-4-7-11-17/h4-15,30H,16H2,1-3H3/b28-20- |
| InChIKey | YWWNECHJACRDJU-RRAHZORUSA-N |
| XLogP | 4.93 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|