C22H34O6 — CID 73350687
dimethyl (1E,3Z,7Z,11S,12R)-11,12-dihydroxy-11-methyl-4-propan-2-ylcyclotetradeca-1,3,7-triene-1,7-dicarboxylate (PubChem CID 73350687) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is dimethyl (1E,3Z,7Z,11S,12R)-11,12-dihydroxy-11-methyl-4-propan-2-ylcyclotetradeca-1,3,7-triene-1,7-dicarboxylate.
| Compound Name | dimethyl (1E,3Z,7Z,11S,12R)-11,12-dihydroxy-11-methyl-4-propan-2-ylcyclotetradeca-1,3,7-triene-1,7-dicarboxylate |
|---|---|
| PubChem CID | 73350687 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | dimethyl (1E,3Z,7Z,11S,12R)-11,12-dihydroxy-11-methyl-4-propan-2-ylcyclotetradeca-1,3,7-triene-1,7-dicarboxylate |
| SMILES | COC(=O)/C1=C\CC[C@](C)(O)[C@H](O)CC/C(C(=O)OC)=C\C=C(/C(C)C)CC1 |
| InChI | InChI=1S/C22H34O6/c1-15(2)16-8-10-17(20(24)27-4)7-6-14-22(3,26)19(23)13-12-18(11-9-16)21(25)28-5/h7,9,11,15,19,23,26H,6,8,10,12-14H2,1-5H3/b16-9-,17-7-,18-11+/t19-,22+/m1/s1 |
| InChIKey | VRJMJUCQLYGVBY-JITFZGDKSA-N |
| XLogP | 3.23 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |