C11H17N3O5 — CID 7335129
5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 7335129) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7335129 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 5-[(1,3-dihydroxy-2-methylpropan-2-yl)iminomethyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | CN1C(=O)C(/C=N/C(C)(CO)CO)C(=O)N(C)C1=O |
| InChI | InChI=1S/C11H17N3O5/c1-11(5-15,6-16)12-4-7-8(17)13(2)10(19)14(3)9(7)18/h4,7,15-16H,5-6H2,1-3H3/b12-4+ |
| InChIKey | KXMYGYLLQNYSKM-UUILKARUSA-N |
| XLogP | -1.53 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|