C30H35N3O6 — CID 73352225
1-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole-5-carboxamide (PubChem CID 73352225) has the molecular formula C30H35N3O6 and a molecular weight of 533.63 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole-5-carboxamide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 73352225 |
| Molecular Formula | C30H35N3O6 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.25 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(2-hydroxyethoxy)ethyl]-2-(1-phenoxyethyl)benzimidazole-5-carboxamide |
| SMILES | COc1ccc(CCn2c(C(C)Oc3ccccc3)nc3cc(C(=O)NCCOCCO)ccc32)cc1OC |
| InChI | InChI=1S/C30H35N3O6/c1-21(39-24-7-5-4-6-8-24)29-32-25-20-23(30(35)31-14-17-38-18-16-34)10-11-26(25)33(29)15-13-22-9-12-27(36-2)28(19-22)37-3/h4-12,19-21,34H,13-18H2,1-3H3,(H,31,35) |
| InChIKey | VEPADYYTVMUNQS-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|