C13H10N4O3 — CID 7335249
(1'S,5'R,6'R)-2'-amino-6'-(furan-2-yl)spiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile (PubChem CID 7335249) has the molecular formula C13H10N4O3 and a molecular weight of 270.25 g/mol. Its IUPAC name is (1'S,5'R,6'R)-2'-amino-6'-(furan-2-yl)spiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile.
| Compound Name | (1'S,5'R,6'R)-2'-amino-6'-(furan-2-yl)spiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
|---|---|
| PubChem CID | 7335249 |
| Molecular Formula | C13H10N4O3 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (1'S,5'R,6'R)-2'-amino-6'-(furan-2-yl)spiro[1,3-dioxolane-2,4'-3-azabicyclo[3.1.0]hex-2-ene]-1',5'-dicarbonitrile |
| SMILES | N#C[C@@]12C(N)=NC3(OCCO3)[C@]1(C#N)[C@@H]2c1ccco1 |
| InChI | InChI=1S/C13H10N4O3/c14-6-11-9(8-2-1-3-18-8)12(11,7-15)13(17-10(11)16)19-4-5-20-13/h1-3,9H,4-5H2,(H2,16,17)/t9-,11-,12-/m1/s1 |
| InChIKey | MEWWSIAZVDOAOG-YUSALJHKSA-N |
| XLogP | 0.47 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |