C18H17N5O2 — CID 6545819
(3'aR,4'R,7'aR)-3'-amino-6'-methyl-4'-phenylspiro[1,3-dioxolane-2,1'-4,5-dihydropyrrolo[3,4-c]pyridine]-3'a,7'a-dicarbonitrile (PubChem CID 6545819) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is (3'aR,4'R,7'aR)-3'-amino-6'-methyl-4'-phenylspiro[1,3-dioxolane-2,1'-4,5-dihydropyrrolo[3,4-c]pyridine]-3'a,7'a-dicarbonitrile.
| Compound Name | (3'aR,4'R,7'aR)-3'-amino-6'-methyl-4'-phenylspiro[1,3-dioxolane-2,1'-4,5-dihydropyrrolo[3,4-c]pyridine]-3'a,7'a-dicarbonitrile |
|---|---|
| PubChem CID | 6545819 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | (3'aR,4'R,7'aR)-3'-amino-6'-methyl-4'-phenylspiro[1,3-dioxolane-2,1'-4,5-dihydropyrrolo[3,4-c]pyridine]-3'a,7'a-dicarbonitrile |
| SMILES | CC1=C[C@@]2(C#N)C3(N=C(N)[C@@]2(C#N)[C@@H](c2ccccc2)N1)OCCO3 |
| InChI | InChI=1S/C18H17N5O2/c1-12-9-16(10-19)17(11-20,14(22-12)13-5-3-2-4-6-13)15(21)23-18(16)24-7-8-25-18/h2-6,9,14,22H,7-8H2,1H3,(H2,21,23)/t14-,16+,17-/m1/s1 |
| InChIKey | LAOBLBUPVWWWQV-HYVNUMGLSA-N |
| XLogP | 1.33 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |