C21H21N5O3 — CID 664554
5'-amino-7'-(4-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene]-2',6'-dicarbonitrile (PubChem CID 664554) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is 5'-amino-7'-(4-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene]-2',6'-dicarbonitrile.
| Compound Name | 5'-amino-7'-(4-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene]-2',6'-dicarbonitrile |
|---|---|
| PubChem CID | 664554 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 5'-amino-7'-(4-methoxyphenyl)spiro[1,3-dioxolane-2,3'-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene]-2',6'-dicarbonitrile |
| SMILES | COc1ccc(C2NC3=C(CCC3)C3(C#N)C4(N=C(N)C23C#N)OCCO4)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-27-14-7-5-13(6-8-14)17-19(11-22)18(24)26-21(28-9-10-29-21)20(19,12-23)15-3-2-4-16(15)25-17/h5-8,17,25H,2-4,9-10H2,1H3,(H2,24,26) |
| InChIKey | ZSCAYYQXWLJZGW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |