C22H25N5S2 — CID 1417997
(2S,6S,7R)-5-amino-3,3-bis(ethylsulfanyl)-7-phenyl-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene-2,6-dicarbonitrile (PubChem CID 1417997) has the molecular formula C22H25N5S2 and a molecular weight of 423.61 g/mol. Its IUPAC name is (2S,6S,7R)-5-amino-3,3-bis(ethylsulfanyl)-7-phenyl-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene-2,6-dicarbonitrile.
| Compound Name | (2S,6S,7R)-5-amino-3,3-bis(ethylsulfanyl)-7-phenyl-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 1417997 |
| Molecular Formula | C22H25N5S2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | (2S,6S,7R)-5-amino-3,3-bis(ethylsulfanyl)-7-phenyl-4,8-diazatricyclo[7.3.0.02,6]dodeca-1(9),4-diene-2,6-dicarbonitrile |
| SMILES | CCSC1(SCC)N=C(N)[C@]2(C#N)[C@@H](c3ccccc3)NC3=C(CCC3)[C@]12C#N |
| InChI | InChI=1S/C22H25N5S2/c1-3-28-22(29-4-2)21(14-24)16-11-8-12-17(16)26-18(15-9-6-5-7-10-15)20(21,13-23)19(25)27-22/h5-7,9-10,18,26H,3-4,8,11-12H2,1-2H3,(H2,25,27)/t18-,20+,21+/m1/s1 |
| InChIKey | HQVCKHDUVHSNFC-GIVPXCGWSA-N |
| XLogP | 4.32 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|