C18H19N5O2 — CID 1418246
(3aR,4S,7aR)-3-amino-1,1-dimethoxy-6-methyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile (PubChem CID 1418246) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (3aR,4S,7aR)-3-amino-1,1-dimethoxy-6-methyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile.
| Compound Name | (3aR,4S,7aR)-3-amino-1,1-dimethoxy-6-methyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile |
|---|---|
| PubChem CID | 1418246 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (3aR,4S,7aR)-3-amino-1,1-dimethoxy-6-methyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile |
| SMILES | COC1(OC)N=C(N)[C@@]2(C#N)[C@H](c3ccccc3)NC(C)=C[C@@]12C#N |
| InChI | InChI=1S/C18H19N5O2/c1-12-9-16(10-19)17(11-20,15(21)23-18(16,24-2)25-3)14(22-12)13-7-5-4-6-8-13/h4-9,14,22H,1-3H3,(H2,21,23)/t14-,16-,17+/m0/s1 |
| InChIKey | HWKYPXMEMPTAHC-BHYGNILZSA-N |
| XLogP | 1.57 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|