C21H25N5S2 — CID 7191005
(3aR,4R,7aR)-3-amino-1,1-bis(ethylsulfanyl)-6,7-dimethyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile (PubChem CID 7191005) has the molecular formula C21H25N5S2 and a molecular weight of 411.60 g/mol. Its IUPAC name is (3aR,4R,7aR)-3-amino-1,1-bis(ethylsulfanyl)-6,7-dimethyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile.
| Compound Name | (3aR,4R,7aR)-3-amino-1,1-bis(ethylsulfanyl)-6,7-dimethyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile |
|---|---|
| PubChem CID | 7191005 |
| Molecular Formula | C21H25N5S2 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (3aR,4R,7aR)-3-amino-1,1-bis(ethylsulfanyl)-6,7-dimethyl-4-phenyl-4,5-dihydropyrrolo[3,4-c]pyridine-3a,7a-dicarbonitrile |
| SMILES | CCSC1(SCC)N=C(N)[C@@]2(C#N)[C@@H](c3ccccc3)NC(C)=C(C)[C@@]12C#N |
| InChI | InChI=1S/C21H25N5S2/c1-5-27-21(28-6-2)20(13-23)14(3)15(4)25-17(16-10-8-7-9-11-16)19(20,12-22)18(24)26-21/h7-11,17,25H,5-6H2,1-4H3,(H2,24,26)/t17-,19-,20-/m1/s1 |
| InChIKey | LAPWMKGSGLMNJI-MISYRCLQSA-N |
| XLogP | 4.18 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|