C22H19N5O2 — CID 73352602
N-(2-methoxyphenyl)-3,6-diphenyl-1H-1,2,4,5-tetrazine-2-carboxamide (PubChem CID 73352602) has the molecular formula C22H19N5O2 and a molecular weight of 385.43 g/mol. Its IUPAC name is N-(2-methoxyphenyl)-3,6-diphenyl-1H-1,2,4,5-tetrazine-2-carboxamide.
| Compound Name | N-(2-methoxyphenyl)-3,6-diphenyl-1H-1,2,4,5-tetrazine-2-carboxamide |
|---|---|
| PubChem CID | 73352602 |
| Molecular Formula | C22H19N5O2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | N-(2-methoxyphenyl)-3,6-diphenyl-1H-1,2,4,5-tetrazine-2-carboxamide |
| SMILES | COc1ccccc1NC(=O)N1NC(c2ccccc2)=NN=C1c1ccccc1 |
| InChI | InChI=1S/C22H19N5O2/c1-29-19-15-9-8-14-18(19)23-22(28)27-21(17-12-6-3-7-13-17)25-24-20(26-27)16-10-4-2-5-11-16/h2-15H,1H3,(H,23,28)(H,24,26) |
| InChIKey | ACAAAHPKWXYFAW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |