C14H20N4O6S — CID 73353253
[(2S)-1-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]sulfamic acid (PubChem CID 73353253) has the molecular formula C14H20N4O6S and a molecular weight of 372.40 g/mol. Its IUPAC name is [(2S)-1-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]sulfamic acid.
| Compound Name | [(2S)-1-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]sulfamic acid |
|---|---|
| PubChem CID | 73353253 |
| Molecular Formula | C14H20N4O6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(2S)-1-[[(2S)-1-[(2-amino-2-oxoethyl)amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]sulfamic acid |
| SMILES | C[C@H](NC(=O)[C@H](Cc1ccccc1)NS(=O)(=O)O)C(=O)NCC(N)=O |
| InChI | InChI=1S/C14H20N4O6S/c1-9(13(20)16-8-12(15)19)17-14(21)11(18-25(22,23)24)7-10-5-3-2-4-6-10/h2-6,9,11,18H,7-8H2,1H3,(H2,15,19)(H,16,20)(H,17,21)(H,22,23,24)/t9-,11-/m0/s1 |
| InChIKey | USFQGMOHFRMCKF-ONGXEEELSA-N |
| XLogP | -1.90 |
| TPSA | 167.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|