C20H12ClF7N2O2S — CID 73353938
N-[[2-chloro-4-(2-fluorophenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzenesulfonamide (PubChem CID 73353938) has the molecular formula C20H12ClF7N2O2S and a molecular weight of 512.83 g/mol. Its IUPAC name is N-[[2-chloro-4-(2-fluorophenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[[2-chloro-4-(2-fluorophenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 73353938 |
| Molecular Formula | C20H12ClF7N2O2S |
| Molecular Weight | 512.83 g/mol |
| Exact Mass | 512.02 |
| IUPAC Name | N-[[2-chloro-4-(2-fluorophenyl)-3-pyridinyl]methyl]-3,5-bis(trifluoromethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCc1c(-c2ccccc2F)ccnc1Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H12ClF7N2O2S/c21-18-16(14(5-6-29-18)15-3-1-2-4-17(15)22)10-30-33(31,32)13-8-11(19(23,24)25)7-12(9-13)20(26,27)28/h1-9,30H,10H2 |
| InChIKey | FEUNVYLEQIVEAF-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.83 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|