C25H33N5S — CID 73355434
1-[3-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-4-phenylpiperazine (PubChem CID 73355434) has the molecular formula C25H33N5S and a molecular weight of 435.64 g/mol. Its IUPAC name is 1-[3-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-4-phenylpiperazine.
| Compound Name | 1-[3-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-4-phenylpiperazine |
|---|---|
| PubChem CID | 73355434 |
| Molecular Formula | C25H33N5S |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[3-[[5-(4-tert-butylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]propyl]-4-phenylpiperazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(SCCCN3CCN(c4ccccc4)CC3)n[nH]2)cc1 |
| InChI | InChI=1S/C25H33N5S/c1-25(2,3)21-12-10-20(11-13-21)23-26-24(28-27-23)31-19-7-14-29-15-17-30(18-16-29)22-8-5-4-6-9-22/h4-6,8-13H,7,14-19H2,1-3H3,(H,26,27,28) |
| InChIKey | RBPCAJASKBJPTB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|