C18H18N2O3 — CID 73355469
3-methoxy-N-[(4-methoxyphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline (PubChem CID 73355469) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-methoxy-N-[(4-methoxyphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline.
| Compound Name | 3-methoxy-N-[(4-methoxyphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline |
|---|---|
| PubChem CID | 73355469 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 3-methoxy-N-[(4-methoxyphenyl)methyl]-4-(1,3-oxazol-5-yl)aniline |
| SMILES | COc1ccc(CNc2ccc(-c3cnco3)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H18N2O3/c1-21-15-6-3-13(4-7-15)10-20-14-5-8-16(17(9-14)22-2)18-11-19-12-23-18/h3-9,11-12,20H,10H2,1-2H3 |
| InChIKey | SJGSZJAVHYOGAA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |