C10H10N3O4+ — CID 7336292
[(3S)-1-(2-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7336292) has the molecular formula C10H10N3O4+ and a molecular weight of 236.21 g/mol. Its IUPAC name is [(3S)-1-(2-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | [(3S)-1-(2-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7336292 |
| Molecular Formula | C10H10N3O4+ |
| Molecular Weight | 236.21 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | [(3S)-1-(2-nitrophenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | [NH3+][C@H]1CC(=O)N(c2ccccc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C10H9N3O4/c11-6-5-9(14)12(10(6)15)7-3-1-2-4-8(7)13(16)17/h1-4,6H,5,11H2/p+1/t6-/m0/s1 |
| InChIKey | YZQCBASAMUPCDK-LURJTMIESA-O |
| XLogP | -0.53 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.21 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|