C25H20N4O3 — CID 73372336
3-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-ethoxyanilino]benzoic acid (PubChem CID 73372336) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is 3-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-ethoxyanilino]benzoic acid.
| Compound Name | 3-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-ethoxyanilino]benzoic acid |
|---|---|
| PubChem CID | 73372336 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 3-[4-[2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2-ethoxyanilino]benzoic acid |
| SMILES | CCOc1cc(C=C(C#N)c2nc3ccccc3[nH]2)ccc1Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C25H20N4O3/c1-2-32-23-13-16(10-11-22(23)27-19-7-5-6-17(14-19)25(30)31)12-18(15-26)24-28-20-8-3-4-9-21(20)29-24/h3-14,27H,2H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | IWAYFECNJKSCCF-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|