C22H25NO4 — CID 73388418
(E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-[2-(hydroxymethyl)phenyl]hex-2-enamide (PubChem CID 73388418) has the molecular formula C22H25NO4 and a molecular weight of 367.45 g/mol. Its IUPAC name is (E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-[2-(hydroxymethyl)phenyl]hex-2-enamide.
| Compound Name | (E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-[2-(hydroxymethyl)phenyl]hex-2-enamide |
|---|---|
| PubChem CID | 73388418 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-[2-(hydroxymethyl)phenyl]hex-2-enamide |
| SMILES | CCC(/C=C/C(=O)Nc1ccccc1CO)=C\c1ccc(OC)cc1OC |
| InChI | InChI=1S/C22H25NO4/c1-4-16(13-17-10-11-19(26-2)14-21(17)27-3)9-12-22(25)23-20-8-6-5-7-18(20)15-24/h5-14,24H,4,15H2,1-3H3,(H,23,25)/b12-9+,16-13+ |
| InChIKey | JKAJTFMSNRRUNM-USJAFLQSSA-N |
| XLogP | 4.18 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|