C23H27NO4 — CID 73388419
(E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-(2-hydroxy-2-phenylethyl)hex-2-enamide (PubChem CID 73388419) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-(2-hydroxy-2-phenylethyl)hex-2-enamide.
| Compound Name | (E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-(2-hydroxy-2-phenylethyl)hex-2-enamide |
|---|---|
| PubChem CID | 73388419 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (E,4E)-4-[(2,4-dimethoxyphenyl)methylidene]-N-(2-hydroxy-2-phenylethyl)hex-2-enamide |
| SMILES | CCC(/C=C/C(=O)NCC(O)c1ccccc1)=C\c1ccc(OC)cc1OC |
| InChI | InChI=1S/C23H27NO4/c1-4-17(14-19-11-12-20(27-2)15-22(19)28-3)10-13-23(26)24-16-21(25)18-8-6-5-7-9-18/h5-15,21,25H,4,16H2,1-3H3,(H,24,26)/b13-10+,17-14+ |
| InChIKey | FOCFDLKLOKXOLO-OZZAOFPBSA-N |
| XLogP | 3.90 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|