C14H17NO4S — CID 88868771
O-[(E)-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl] N-ethylcarbamothioate (PubChem CID 88868771) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is O-[(E)-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl] N-ethylcarbamothioate.
| Compound Name | O-[(E)-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl] N-ethylcarbamothioate |
|---|---|
| PubChem CID | 88868771 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | O-[(E)-1-(2,4-dimethoxyphenyl)-3-oxoprop-1-en-2-yl] N-ethylcarbamothioate |
| SMILES | CCNC(=S)O/C(C=O)=C/c1ccc(OC)cc1OC |
| InChI | InChI=1S/C14H17NO4S/c1-4-15-14(20)19-12(9-16)7-10-5-6-11(17-2)8-13(10)18-3/h5-9H,4H2,1-3H3,(H,15,20)/b12-7+ |
| InChIKey | CHYZDQALCPXBSG-KPKJPENVSA-N |
| XLogP | 2.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|