C13H12Cl2N4 — CID 73389731
4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine (PubChem CID 73389731) has the molecular formula C13H12Cl2N4 and a molecular weight of 295.17 g/mol. Its IUPAC name is 4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 73389731 |
| Molecular Formula | C13H12Cl2N4 |
| Molecular Weight | 295.17 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-N-cyclopropyl-6-(2,3-dichlorophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NC2CC2)cc(-c2cccc(Cl)c2Cl)n1 |
| InChI | InChI=1S/C13H12Cl2N4/c14-9-3-1-2-8(12(9)15)10-6-11(17-7-4-5-7)19-13(16)18-10/h1-3,6-7H,4-5H2,(H3,16,17,18,19) |
| InChIKey | PNMYJIOQIAEYQL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.17 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |