C14H17BrN2O2 — CID 73389762
N-[1-(2-bromophenyl)ethyl]-6-oxopiperidine-3-carboxamide (PubChem CID 73389762) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is N-[1-(2-bromophenyl)ethyl]-6-oxopiperidine-3-carboxamide.
| Compound Name | N-[1-(2-bromophenyl)ethyl]-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 73389762 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-[1-(2-bromophenyl)ethyl]-6-oxopiperidine-3-carboxamide |
| SMILES | CC(NC(=O)C1CCC(=O)NC1)c1ccccc1Br |
| InChI | InChI=1S/C14H17BrN2O2/c1-9(11-4-2-3-5-12(11)15)17-14(19)10-6-7-13(18)16-8-10/h2-5,9-10H,6-8H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | FMSSAHVRJBEIIT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |