C16H23BrN2O — CID 81397693
4-(aminomethyl)-N-[(1S)-1-(2-bromophenyl)ethyl]cyclohexane-1-carboxamide (PubChem CID 81397693) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(1S)-1-(2-bromophenyl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[(1S)-1-(2-bromophenyl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 81397693 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 4-(aminomethyl)-N-[(1S)-1-(2-bromophenyl)ethyl]cyclohexane-1-carboxamide |
| SMILES | C[C@H](NC(=O)C1CCC(CN)CC1)c1ccccc1Br |
| InChI | InChI=1S/C16H23BrN2O/c1-11(14-4-2-3-5-15(14)17)19-16(20)13-8-6-12(10-18)7-9-13/h2-5,11-13H,6-10,18H2,1H3,(H,19,20)/t11-,12?,13?/m0/s1 |
| InChIKey | AXAAZSYDVWZFGI-HIFPTAJRSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |