C27H33N3O3 — CID 73399864
N-(4-butylphenyl)-6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)hexanamide (PubChem CID 73399864) has the molecular formula C27H33N3O3 and a molecular weight of 447.58 g/mol. Its IUPAC name is N-(4-butylphenyl)-6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)hexanamide.
| Compound Name | N-(4-butylphenyl)-6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)hexanamide |
|---|---|
| PubChem CID | 73399864 |
| Molecular Formula | C27H33N3O3 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | N-(4-butylphenyl)-6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)hexanamide |
| SMILES | CCCCc1ccc(NC(=O)CCCCCN2C(=O)C3Cc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C27H33N3O3/c1-2-3-9-20-13-15-23(16-14-20)28-25(31)12-5-4-8-17-29-26(32)24-18-21-10-6-7-11-22(21)19-30(24)27(29)33/h6-7,10-11,13-16,24H,2-5,8-9,12,17-19H2,1H3,(H,28,31) |
| InChIKey | AJDCOUVEWQHILO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|