C24H27N3O3 — CID 78517831
N-(4-butylphenyl)-3-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)propanamide (PubChem CID 78517831) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-(4-butylphenyl)-3-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)propanamide.
| Compound Name | N-(4-butylphenyl)-3-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)propanamide |
|---|---|
| PubChem CID | 78517831 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-(4-butylphenyl)-3-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)propanamide |
| SMILES | CCCCc1ccc(NC(=O)CCN2C(=O)C3Cc4ccccc4CN3C2=O)cc1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-3-6-17-9-11-20(12-10-17)25-22(28)13-14-26-23(29)21-15-18-7-4-5-8-19(18)16-27(21)24(26)30/h4-5,7-12,21H,2-3,6,13-16H2,1H3,(H,25,28) |
| InChIKey | UTFXGXNRAWAHGY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|