C25H29N3O3 — CID 73399812
6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)-N-(1-phenylethyl)hexanamide (PubChem CID 73399812) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)-N-(1-phenylethyl)hexanamide.
| Compound Name | 6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)-N-(1-phenylethyl)hexanamide |
|---|---|
| PubChem CID | 73399812 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 6-(1,3-dioxo-10,10a-dihydro-5H-imidazo[1,5-b]isoquinolin-2-yl)-N-(1-phenylethyl)hexanamide |
| SMILES | CC(NC(=O)CCCCCN1C(=O)C2Cc3ccccc3CN2C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H29N3O3/c1-18(19-10-4-2-5-11-19)26-23(29)14-6-3-9-15-27-24(30)22-16-20-12-7-8-13-21(20)17-28(22)25(27)31/h2,4-5,7-8,10-13,18,22H,3,6,9,14-17H2,1H3,(H,26,29) |
| InChIKey | LMJZUSGNFXANIL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|