C17H19BrO3 — CID 73401456
7-(2-bromoethoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 73401456) has the molecular formula C17H19BrO3 and a molecular weight of 351.24 g/mol. Its IUPAC name is 7-(2-bromoethoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-(2-bromoethoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 73401456 |
| Molecular Formula | C17H19BrO3 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 7-(2-bromoethoxy)-3-phenyl-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C(c2ccccc2)=COC2CC(OCCBr)CCC12 |
| InChI | InChI=1S/C17H19BrO3/c18-8-9-20-13-6-7-14-16(10-13)21-11-15(17(14)19)12-4-2-1-3-5-12/h1-5,11,13-14,16H,6-10H2 |
| InChIKey | MFGWUXKFNCYFTN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|