C17H18Br2O3 — CID 73401649
7-(2-bromoethoxy)-3-(4-bromophenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 73401649) has the molecular formula C17H18Br2O3 and a molecular weight of 430.14 g/mol. Its IUPAC name is 7-(2-bromoethoxy)-3-(4-bromophenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 7-(2-bromoethoxy)-3-(4-bromophenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 73401649 |
| Molecular Formula | C17H18Br2O3 |
| Molecular Weight | 430.14 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | 7-(2-bromoethoxy)-3-(4-bromophenyl)-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C(c2ccc(Br)cc2)=COC2CC(OCCBr)CCC12 |
| InChI | InChI=1S/C17H18Br2O3/c18-7-8-21-13-5-6-14-16(9-13)22-10-15(17(14)20)11-1-3-12(19)4-2-11/h1-4,10,13-14,16H,5-9H2 |
| InChIKey | UZOAJWOQJNHQDU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.14 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|