C32H32Br2O6 — CID 73401435
3-(4-bromophenyl)-7-[2-[[3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one (PubChem CID 73401435) has the molecular formula C32H32Br2O6 and a molecular weight of 672.41 g/mol. Its IUPAC name is 3-(4-bromophenyl)-7-[2-[[3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one.
| Compound Name | 3-(4-bromophenyl)-7-[2-[[3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
|---|---|
| PubChem CID | 73401435 |
| Molecular Formula | C32H32Br2O6 |
| Molecular Weight | 672.41 g/mol |
| Exact Mass | 670.06 |
| IUPAC Name | 3-(4-bromophenyl)-7-[2-[[3-(4-bromophenyl)-4-oxo-4a,5,6,7,8,8a-hexahydrochromen-7-yl]oxy]ethoxy]-4a,5,6,7,8,8a-hexahydrochromen-4-one |
| SMILES | O=C1C(c2ccc(Br)cc2)=COC2CC(OCCOC3CCC4C(=O)C(c5ccc(Br)cc5)=COC4C3)CCC12 |
| InChI | InChI=1S/C32H32Br2O6/c33-21-5-1-19(2-6-21)27-17-39-29-15-23(9-11-25(29)31(27)35)37-13-14-38-24-10-12-26-30(16-24)40-18-28(32(26)36)20-3-7-22(34)8-4-20/h1-8,17-18,23-26,29-30H,9-16H2 |
| InChIKey | KCQKHTGHLXXCDJ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.41 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|