C19H18FN3O3S — CID 7340187
[(Z)-[(2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-fluoro-2,3-dihydrochromen-4-ylidene]amino]thiourea (PubChem CID 7340187) has the molecular formula C19H18FN3O3S and a molecular weight of 387.44 g/mol. Its IUPAC name is [(Z)-[(2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-fluoro-2,3-dihydrochromen-4-ylidene]amino]thiourea.
| Compound Name | [(Z)-[(2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-fluoro-2,3-dihydrochromen-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 7340187 |
| Molecular Formula | C19H18FN3O3S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [(Z)-[(2S)-2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-6-fluoro-2,3-dihydrochromen-4-ylidene]amino]thiourea |
| SMILES | NC(=S)N/N=C1/C[C@@H](c2ccc3c(c2)OCCCO3)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C19H18FN3O3S/c20-12-3-5-15-13(9-12)14(22-23-19(21)27)10-17(26-15)11-2-4-16-18(8-11)25-7-1-6-24-16/h2-5,8-9,17H,1,6-7,10H2,(H3,21,23,27)/b22-14-/t17-/m0/s1 |
| InChIKey | KZXMQMPRSMZAFD-CPEHUTGBSA-N |
| XLogP | 3.05 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|