About [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate
[(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate (PubChem CID 7340245) has the molecular formula C10H19N2O2+
and a molecular weight of 199.27 g/mol. Its IUPAC name is [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate.
Molecular Properties
| Compound Name | [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate |
| PubChem CID | 7340245 |
| Molecular Formula | C10H19N2O2+ |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate |
| SMILES | [H]/N=C(\C)CC(=O)O[C@@H]1CCC[NH+](C)C1 |
| InChI | InChI=1S/C10H18N2O2/c1-8(11)6-10(13)14-9-4-3-5-12(2)7-9/h9,11H,3-7H2,1-2H3/p+1/b11-8+/t9-/m1/s1 |
| InChIKey | NDHVUCPACVVAJI-FJUNDMEASA-O |
| XLogP | -0.36 |
| TPSA | 54.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate?
The IUPAC name of [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate (CID 7340245) is [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate.
What is the SMILES notation for [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate?
The canonical SMILES for [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate is [H]/N=C(\C)CC(=O)O[C@@H]1CCC[NH+](C)C1.
What is the InChIKey of [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate?
The InChIKey is NDHVUCPACVVAJI-FJUNDMEASA-O. The full InChI is InChI=1S/C10H18N2O2/c1-8(11)6-10(13)14-9-4-3-5-12(2)7-9/h9,11H,3-7H2,1-2H3/p+1/b11-8+/t9-/m1/s1.
What are the key properties of [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate?
[(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate has a molecular weight of 199.27 g/mol, XLogP of -0.36, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-1-methylpiperidin-1-ium-3-yl] 3-iminobutanoate is sourced from PubChem (CID 7340245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).