C12H19N3O2 — CID 73402979
1-butyl-N'-hydroxy-4,6-dimethyl-2-oxopyridine-3-carboximidamide (PubChem CID 73402979) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-butyl-N'-hydroxy-4,6-dimethyl-2-oxopyridine-3-carboximidamide.
| Compound Name | 1-butyl-N'-hydroxy-4,6-dimethyl-2-oxopyridine-3-carboximidamide |
|---|---|
| PubChem CID | 73402979 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-butyl-N'-hydroxy-4,6-dimethyl-2-oxopyridine-3-carboximidamide |
| SMILES | CCCCn1c(C)cc(C)c(C(N)=NO)c1=O |
| InChI | InChI=1S/C12H19N3O2/c1-4-5-6-15-9(3)7-8(2)10(12(15)16)11(13)14-17/h7,17H,4-6H2,1-3H3,(H2,13,14) |
| InChIKey | CFOMHULVELKLAT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|