C16H23NO5 — CID 67893450
diethyl 1-butyl-6-methyl-4-oxopyridine-2,3-dicarboxylate (PubChem CID 67893450) has the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. Its IUPAC name is diethyl 1-butyl-6-methyl-4-oxopyridine-2,3-dicarboxylate.
| Compound Name | diethyl 1-butyl-6-methyl-4-oxopyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 67893450 |
| Molecular Formula | C16H23NO5 |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | diethyl 1-butyl-6-methyl-4-oxopyridine-2,3-dicarboxylate |
| SMILES | CCCCn1c(C)cc(=O)c(C(=O)OCC)c1C(=O)OCC |
| InChI | InChI=1S/C16H23NO5/c1-5-8-9-17-11(4)10-12(18)13(15(19)21-6-2)14(17)16(20)22-7-3/h10H,5-9H2,1-4H3 |
| InChIKey | AFGBHAYLIWJNPB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |