About ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate
ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate (PubChem CID 124823452) has the molecular formula C19H22BrNO3
and a molecular weight of 392.29 g/mol. Its IUPAC name is ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate |
| PubChem CID | 124823452 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate |
| SMILES | CCCCn1c(C)c(C(=O)OCC)c2c3cc(C)oc3c(Br)cc21 |
| InChI | InChI=1S/C19H22BrNO3/c1-5-7-8-21-12(4)16(19(22)23-6-2)17-13-9-11(3)24-18(13)14(20)10-15(17)21/h9-10H,5-8H2,1-4H3 |
| InChIKey | AGRDCMHGPYTGLK-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate?
The IUPAC name of ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate (CID 124823452) is ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate.
What is the SMILES notation for ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate?
The canonical SMILES for ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate is CCCCn1c(C)c(C(=O)OCC)c2c3cc(C)oc3c(Br)cc21.
What is the InChIKey of ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate?
The InChIKey is AGRDCMHGPYTGLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22BrNO3/c1-5-7-8-21-12(4)16(19(22)23-6-2)17-13-9-11(3)24-18(13)14(20)10-15(17)21/h9-10H,5-8H2,1-4H3.
What are the key properties of ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate?
ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate has a molecular weight of 392.29 g/mol, XLogP of 5.74, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-bromo-6-butyl-2,7-dimethylfuro[3,2-e]indole-8-carboxylate is sourced from PubChem (CID 124823452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).