C33H27F5O6S — CID 73408903
[3-hydroxy-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl 2,3,4,5,6-pentafluorobenzoate (PubChem CID 73408903) has the molecular formula C33H27F5O6S and a molecular weight of 646.63 g/mol. Its IUPAC name is [3-hydroxy-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [3-hydroxy-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 73408903 |
| Molecular Formula | C33H27F5O6S |
| Molecular Weight | 646.63 g/mol |
| Exact Mass | 646.14 |
| IUPAC Name | [3-hydroxy-4,5-bis(phenylmethoxy)-6-phenylsulfanyloxan-2-yl]methyl 2,3,4,5,6-pentafluorobenzoate |
| SMILES | O=C(OCC1OC(Sc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C33H27F5O6S/c34-24-23(25(35)27(37)28(38)26(24)36)32(40)43-18-22-29(39)30(41-16-19-10-4-1-5-11-19)31(42-17-20-12-6-2-7-13-20)33(44-22)45-21-14-8-3-9-15-21/h1-15,22,29-31,33,39H,16-18H2 |
| InChIKey | OVYJFRKVTAXMHU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|