C30H33N3O11 — CID 73409887
6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one (PubChem CID 73409887) has the molecular formula C30H33N3O11 and a molecular weight of 611.60 g/mol. Its IUPAC name is 6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one.
| Compound Name | 6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 73409887 |
| Molecular Formula | C30H33N3O11 |
| Molecular Weight | 611.60 g/mol |
| Exact Mass | 611.21 |
| IUPAC Name | 6-[3,4,5-trihydroxy-6-[(3,4,5-trihydroxy-6-methyloxan-2-yl)oxymethyl]oxan-2-yl]oxy-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4(9),5,7,15,17,19-octaen-14-one |
| SMILES | CC1OC(OCC2OC(Oc3ccc4c5c([nH]c4c3)-c3nc4ccccc4c(=O)n3CC5)C(O)C(O)C2O)C(O)C(O)C1O |
| InChI | InChI=1S/C30H33N3O11/c1-12-21(34)23(36)25(38)29(42-12)41-11-19-22(35)24(37)26(39)30(44-19)43-13-6-7-14-15-8-9-33-27(20(15)31-18(14)10-13)32-17-5-3-2-4-16(17)28(33)40/h2-7,10,12,19,21-26,29-31,34-39H,8-9,11H2,1H3 |
| InChIKey | DNQCYAUQIUWPOA-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 208.98 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.60 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|