C16H24N4O3S2 — CID 7341093
N-[(2S)-1-[2-(ethylcarbamothioyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-methoxybenzamide (PubChem CID 7341093) has the molecular formula C16H24N4O3S2 and a molecular weight of 384.53 g/mol. Its IUPAC name is N-[(2S)-1-[2-(ethylcarbamothioyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-methoxybenzamide.
| Compound Name | N-[(2S)-1-[2-(ethylcarbamothioyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 7341093 |
| Molecular Formula | C16H24N4O3S2 |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[(2S)-1-[2-(ethylcarbamothioyl)hydrazinyl]-4-methylsulfanyl-1-oxobutan-2-yl]-4-methoxybenzamide |
| SMILES | CCNC(=S)NNC(=O)[C@H](CCSC)NC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H24N4O3S2/c1-4-17-16(24)20-19-15(22)13(9-10-25-3)18-14(21)11-5-7-12(23-2)8-6-11/h5-8,13H,4,9-10H2,1-3H3,(H,18,21)(H,19,22)(H2,17,20,24)/t13-/m0/s1 |
| InChIKey | YSBYPHKLKRMXNE-ZDUSSCGKSA-N |
| XLogP | 1.06 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|