C13H25NO6Si — CID 73414943
2-(2-amino-2-oxoethylidene)-3-triethoxysilylpentanoic acid (PubChem CID 73414943) has the molecular formula C13H25NO6Si and a molecular weight of 319.43 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethylidene)-3-triethoxysilylpentanoic acid.
| Compound Name | 2-(2-amino-2-oxoethylidene)-3-triethoxysilylpentanoic acid |
|---|---|
| PubChem CID | 73414943 |
| Molecular Formula | C13H25NO6Si |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 2-(2-amino-2-oxoethylidene)-3-triethoxysilylpentanoic acid |
| SMILES | CCO[Si](OCC)(OCC)C(CC)C(=CC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H25NO6Si/c1-5-11(10(13(16)17)9-12(14)15)21(18-6-2,19-7-3)20-8-4/h9,11H,5-8H2,1-4H3,(H2,14,15)(H,16,17) |
| InChIKey | ZGGUELKFUXYEAM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 108.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|