C20H32O8 — CID 175822658
diethyl 2-[(E)-but-2-en-2-yl]propanedioate;(E)-2-pentan-3-ylbut-2-enedioic acid (PubChem CID 175822658) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is diethyl 2-[(E)-but-2-en-2-yl]propanedioate;(E)-2-pentan-3-ylbut-2-enedioic acid.
| Compound Name | diethyl 2-[(E)-but-2-en-2-yl]propanedioate;(E)-2-pentan-3-ylbut-2-enedioic acid |
|---|---|
| PubChem CID | 175822658 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | diethyl 2-[(E)-but-2-en-2-yl]propanedioate;(E)-2-pentan-3-ylbut-2-enedioic acid |
| SMILES | C/C=C(\C)C(C(=O)OCC)C(=O)OCC.CCC(CC)/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18O4.C9H14O4/c1-5-8(4)9(10(12)14-6-2)11(13)15-7-3;1-3-6(4-2)7(9(12)13)5-8(10)11/h5,9H,6-7H2,1-4H3;5-6H,3-4H2,1-2H3,(H,10,11)(H,12,13)/b8-5+;7-5+ |
| InChIKey | WLJUREDBLDMLSG-HWDKPCIZSA-N |
| XLogP | 3.21 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|