C7H8N2O6 — CID 88820236
(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid (PubChem CID 88820236) has the molecular formula C7H8N2O6 and a molecular weight of 216.15 g/mol. Its IUPAC name is (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid.
| Compound Name | (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 88820236 |
| Molecular Formula | C7H8N2O6 |
| Molecular Weight | 216.15 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid |
| SMILES | NC(=O)C(C(N)=O)/C(=C\C(=O)O)C(=O)O |
| InChI | InChI=1S/C7H8N2O6/c8-5(12)4(6(9)13)2(7(14)15)1-3(10)11/h1,4H,(H2,8,12)(H2,9,13)(H,10,11)(H,14,15)/b2-1+ |
| InChIKey | HBSOPISBUMYXAB-OWOJBTEDSA-N |
| XLogP | -2.33 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.15 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|