(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid

C7H8N2O6 — CID 88820236

IUPAC(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid
SMILESNC(=O)C(C(N)=O)/C(=C\C(=O)O)C(=O)O
InChIInChI=1S/C7H8N2O6/c8-5(12)4(6(9)13)2(7(14)15)1-3(10)11/h1,4H,(H2,8,12)(H2,9,13)(H,10,11)(H,14,15)/b2-1+
InChIKeyHBSOPISBUMYXAB-OWOJBTEDSA-N
MW216.15 g/mol
LogP-2.33
Rot. Bonds5

About (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid

(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid (PubChem CID 88820236) has the molecular formula C7H8N2O6 and a molecular weight of 216.15 g/mol. Its IUPAC name is (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid.

Molecular Properties

Compound Name(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid
PubChem CID88820236
Molecular FormulaC7H8N2O6
Molecular Weight216.15 g/mol
Exact Mass216.04
IUPAC Name(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid
SMILESNC(=O)C(C(N)=O)/C(=C\C(=O)O)C(=O)O
InChIInChI=1S/C7H8N2O6/c8-5(12)4(6(9)13)2(7(14)15)1-3(10)11/h1,4H,(H2,8,12)(H2,9,13)(H,10,11)(H,14,15)/b2-1+
InChIKeyHBSOPISBUMYXAB-OWOJBTEDSA-N
XLogP-2.33
TPSA160.78 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.15
LogP ≤ 5-2.33
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid?
The IUPAC name of (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid (CID 88820236) is (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid.
What is the SMILES notation for (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid?
The canonical SMILES for (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid is NC(=O)C(C(N)=O)/C(=C\C(=O)O)C(=O)O.
What is the InChIKey of (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid?
The InChIKey is HBSOPISBUMYXAB-OWOJBTEDSA-N. The full InChI is InChI=1S/C7H8N2O6/c8-5(12)4(6(9)13)2(7(14)15)1-3(10)11/h1,4H,(H2,8,12)(H2,9,13)(H,10,11)(H,14,15)/b2-1+.
What are the key properties of (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid?
(E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid has a molecular weight of 216.15 g/mol, XLogP of -2.33, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(1,3-diamino-1,3-dioxopropan-2-yl)but-2-enedioic acid is sourced from PubChem (CID 88820236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).