C5H6O8P- — CID 170514960
(E)-4-hydroxy-2-[hydroxy(phosphono)methyl]-4-oxobut-2-enoate (PubChem CID 170514960) has the molecular formula C5H6O8P- and a molecular weight of 225.07 g/mol. Its IUPAC name is (E)-4-hydroxy-2-[hydroxy(phosphono)methyl]-4-oxobut-2-enoate.
| Compound Name | (E)-4-hydroxy-2-[hydroxy(phosphono)methyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 170514960 |
| Molecular Formula | C5H6O8P- |
| Molecular Weight | 225.07 g/mol |
| Exact Mass | 224.98 |
| IUPAC Name | (E)-4-hydroxy-2-[hydroxy(phosphono)methyl]-4-oxobut-2-enoate |
| SMILES | O=C(O)/C=C(\C(=O)[O-])C(O)P(=O)(O)O |
| InChI | InChI=1S/C5H7O8P/c6-3(7)1-2(4(8)9)5(10)14(11,12)13/h1,5,10H,(H,6,7)(H,8,9)(H2,11,12,13)/p-1/b2-1+ |
| InChIKey | HGGAWKPCOKYWSX-OWOJBTEDSA-M |
| XLogP | -2.76 |
| TPSA | 155.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.07 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|