C5H8O11P2 — CID 91125864
(1,5-dihydroxy-2,3,4-trioxo-5-phosphonopentyl)phosphonic acid (PubChem CID 91125864) has the molecular formula C5H8O11P2 and a molecular weight of 306.06 g/mol. Its IUPAC name is (1,5-dihydroxy-2,3,4-trioxo-5-phosphonopentyl)phosphonic acid.
| Compound Name | (1,5-dihydroxy-2,3,4-trioxo-5-phosphonopentyl)phosphonic acid |
|---|---|
| PubChem CID | 91125864 |
| Molecular Formula | C5H8O11P2 |
| Molecular Weight | 306.06 g/mol |
| Exact Mass | 305.95 |
| IUPAC Name | (1,5-dihydroxy-2,3,4-trioxo-5-phosphonopentyl)phosphonic acid |
| SMILES | O=C(C(=O)C(O)P(=O)(O)O)C(=O)C(O)P(=O)(O)O |
| InChI | InChI=1S/C5H8O11P2/c6-1(2(7)4(9)17(11,12)13)3(8)5(10)18(14,15)16/h4-5,9-10H,(H2,11,12,13)(H2,14,15,16) |
| InChIKey | KKVRHCARUDVMRU-UHFFFAOYSA-N |
| XLogP | -3.31 |
| TPSA | 206.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.06 |
| LogP ≤ 5 | -3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|