C21H23N5O3 — CID 73426211
1-(3-ethoxyphenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide (PubChem CID 73426211) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide.
| Compound Name | 1-(3-ethoxyphenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 73426211 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1-(3-ethoxyphenyl)-N-[4-[(2S)-morpholin-2-yl]phenyl]triazole-4-carboxamide |
| SMILES | CCOc1cccc(-n2cc(C(=O)Nc3ccc([C@H]4CNCCO4)cc3)nn2)c1 |
| InChI | InChI=1S/C21H23N5O3/c1-2-28-18-5-3-4-17(12-18)26-14-19(24-25-26)21(27)23-16-8-6-15(7-9-16)20-13-22-10-11-29-20/h3-9,12,14,20,22H,2,10-11,13H2,1H3,(H,23,27)/t20-/m1/s1 |
| InChIKey | RAPKLKHDURZSNE-HXUWFJFHSA-N |
| XLogP | 2.58 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |