C14H18N2OS2 — CID 73427307
1-(1,3-dithian-2-ylidene)propyl-(3-methoxyphenyl)diazene (PubChem CID 73427307) has the molecular formula C14H18N2OS2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-(1,3-dithian-2-ylidene)propyl-(3-methoxyphenyl)diazene.
| Compound Name | 1-(1,3-dithian-2-ylidene)propyl-(3-methoxyphenyl)diazene |
|---|---|
| PubChem CID | 73427307 |
| Molecular Formula | C14H18N2OS2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(1,3-dithian-2-ylidene)propyl-(3-methoxyphenyl)diazene |
| SMILES | CCC(/N=N/c1cccc(OC)c1)=C1SCCCS1 |
| InChI | InChI=1S/C14H18N2OS2/c1-3-13(14-18-8-5-9-19-14)16-15-11-6-4-7-12(10-11)17-2/h4,6-7,10H,3,5,8-9H2,1-2H3/b16-15+ |
| InChIKey | QEVODTHYUWJJBL-FOCLMDBBSA-N |
| XLogP | 5.23 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|