C17H21F6N3O2 — CID 73427504
ethyl 4-[[di(propan-2-yl)amino]diazenyl]-3,5-bis(trifluoromethyl)benzoate (PubChem CID 73427504) has the molecular formula C17H21F6N3O2 and a molecular weight of 413.36 g/mol. Its IUPAC name is ethyl 4-[[di(propan-2-yl)amino]diazenyl]-3,5-bis(trifluoromethyl)benzoate.
| Compound Name | ethyl 4-[[di(propan-2-yl)amino]diazenyl]-3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 73427504 |
| Molecular Formula | C17H21F6N3O2 |
| Molecular Weight | 413.36 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | ethyl 4-[[di(propan-2-yl)amino]diazenyl]-3,5-bis(trifluoromethyl)benzoate |
| SMILES | CCOC(=O)c1cc(C(F)(F)F)c(/N=N/N(C(C)C)C(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H21F6N3O2/c1-6-28-15(27)11-7-12(16(18,19)20)14(13(8-11)17(21,22)23)24-25-26(9(2)3)10(4)5/h7-10H,6H2,1-5H3/b25-24+ |
| InChIKey | CDVFKJVQQYBCLD-OCOZRVBESA-N |
| XLogP | 6.02 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.36 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|