C17H17N5O3 — CID 7343196
(10R)-10-(2-ethoxyphenyl)-7-methyl-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione (PubChem CID 7343196) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is (10R)-10-(2-ethoxyphenyl)-7-methyl-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione.
| Compound Name | (10R)-10-(2-ethoxyphenyl)-7-methyl-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
|---|---|
| PubChem CID | 7343196 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (10R)-10-(2-ethoxyphenyl)-7-methyl-2,3,5,7,13-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5-triene-8,12-dione |
| SMILES | CCOc1ccccc1[C@H]1CC(=O)Nc2c1c(=O)n(C)c1ncnn21 |
| InChI | InChI=1S/C17H17N5O3/c1-3-25-12-7-5-4-6-10(12)11-8-13(23)20-15-14(11)16(24)21(2)17-18-9-19-22(15)17/h4-7,9,11H,3,8H2,1-2H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | NOMLWTJQIVYEQA-LLVKDONJSA-N |
| XLogP | 1.30 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |